(5-Formyl-2-methylphenyl)boronic acid 95+%
cas: 1186398-35-5 — see every product listed under this CAS number, including other names
(5-Formyl-2-methylphenyl)boronic acid 95+% (CAS 1186398-35-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A401980-100mg |
| cas | 1186398-35-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1722.06 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A401980 |
(5-formyl-2-methylphenyl)boronic acid (CAS 1186398-35-5) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (5-formyl-2-methylphenyl)boronic acid. InChIKey: VBQDWWUYMAWKHV-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (5-formyl-2-methylphenyl)boronic acid |
| InChIKey | VBQDWWUYMAWKHV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C=O)C)(O)O |
Computed by PubChem (NCBI)