(5-Isopropoxy-2-methylphenyl)boronic acid, 98%
cas: 1451390-99-0 — see every product listed under this CAS number, including other names
(5-Isopropoxy-2-methylphenyl)boronic acid, 98% (CAS 1451390-99-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A105902-250mg |
| cas | 1451390-99-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2461.88 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 336.57 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2646.87 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1994.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2-methyl-5-propan-2-yloxyphenyl)boronic acid (CAS 1451390-99-0) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (2-methyl-5-propan-2-yloxyphenyl)boronic acid. InChIKey: GOZKXGDILPLHDM-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (2-methyl-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | GOZKXGDILPLHDM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(C)C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Isopropoxy-2-methylphenylboronic acid, (5-Isopropoxy-2-methylphenyl)boronic acid, (2-methyl-5-propan-2-yloxyphenyl)boronic acid, Boronic acid, B-[2-methyl-5-(1-methylethoxy)phenyl]-, (5-isopropoxy-2-methyl-phenyl)boronic acid, [2-methyl-5-(propan-2-yloxy)phenyl]boronic acid, {2-Methyl-5-[(propan-2-yl)oxy]phenyl}boronic acid
