Products 1451391-67-5
CAS 1451391-67-5 appears in our catalog under these names: 4-Ethoxy-2,3-dimethylphenylboronic acid, 95%, (4-Ethoxy-2,3-dimethylphenyl)boronic acid, 98%, 4-Ethoxy-2,3-dimethylphenylboronic acid, ≥95%, ≥95%, 4-Ethoxy-2,3-dimethylphenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4-ethoxy-2,3-dimethylphenyl)boronic acid (CAS 1451391-67-5) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-ethoxy-2,3-dimethylphenyl)boronic acid. InChIKey: UXAVIFNGKPGZPI-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (4-ethoxy-2,3-dimethylphenyl)boronic acid |
| InChIKey | UXAVIFNGKPGZPI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)C)C)(O)O |
Computed by PubChem (NCBI)