CAS 290348-01-5 is the registry number for 4-Methoxy-3-(1-methylethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4-methoxy-3-propan-2-ylphenyl)boronic acid (CAS 290348-01-5) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-methoxy-3-propan-2-ylphenyl)boronic acid. InChIKey: ILKURCOQRCUYRU-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (4-methoxy-3-propan-2-ylphenyl)boronic acid |
| InChIKey | ILKURCOQRCUYRU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)C(C)C)(O)O |
Computed by PubChem (NCBI)