Products 290348-01-5

CAS 290348-01-5 is the registry number for 4-Methoxy-3-(1-methylethyl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(4-methoxy-3-propan-2-ylphenyl)boronic acid (CAS 290348-01-5) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-methoxy-3-propan-2-ylphenyl)boronic acid. InChIKey: ILKURCOQRCUYRU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BO3
Molecular weight194.04 g/mol
IUPAC name(4-methoxy-3-propan-2-ylphenyl)boronic acid
InChIKeyILKURCOQRCUYRU-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)OC)C(C)C)(O)O

Computed by PubChem (NCBI)