Products 1451391-64-2
CAS 1451391-64-2 appears in our catalog under these names: 2-Methyl-5-propoxyphenylboronic acid, 95%, 2-Methyl-5-propoxyphenylboronic acid, ≥95%, (2-Methyl-5-propoxyphenyl)boronic acid, 98%, 2-Methyl-5-propoxyphenylboronic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
(2-methyl-5-propoxyphenyl)boronic acid (CAS 1451391-64-2) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (2-methyl-5-propoxyphenyl)boronic acid. InChIKey: PIGHFUHZRWCYCY-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (2-methyl-5-propoxyphenyl)boronic acid |
| InChIKey | PIGHFUHZRWCYCY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCCC)C)(O)O |
Computed by PubChem (NCBI)