Products 850568-09-1
CAS 850568-09-1 appears in our catalog under these names: 4-Isopropoxy-3-methylphenylboronic acid, 98%, 4–Isopropoxy–3–methylphenylboronic acid, 4-Isopropoxy-3-methylphenylboronic acid 98%, 4-Isopropoxy-3-methylphenylboronic acid, 98%, 98%, 4-Isopropoxy-3-methylphenylboronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
(3-methyl-4-propan-2-yloxyphenyl)boronic acid (CAS 850568-09-1) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (3-methyl-4-propan-2-yloxyphenyl)boronic acid. InChIKey: XRGBZDZYYQVOJZ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (3-methyl-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | XRGBZDZYYQVOJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(C)C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Isopropoxy-3-methylphenylboronic acid, (4-isopropoxy-3-methylphenyl)boronic acid, (3-methyl-4-propan-2-yloxyphenyl)boronic acid, 4-Isopropoxy-3-methylbenzeneboronic acid, (4-isopropoxy-3-methyl-phenyl)boronic acid, XRGBZDZYYQVOJZ-UHFFFAOYSA-N, {3-Methyl-4-[(propan-2-yl)oxy]phenyl}boronic acid