cas: 1008140-70-2 — see every product listed under this CAS number, including other names
(6-(Trifluoromethoxy)pyridin-3-yl)boronic acid, 97% (CAS 1008140-70-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F230510-25MG |
| cas | 1008140-70-2 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 476.93 Pln | |
| Fluorochem | 100mg | 935.11 Pln | |
| Fluorochem | 250mg | 1611.95 Pln | |
| Fluorochem | 1g | 3845.54 Pln | |
| Fluorochem | 5g | 11639.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[6-(trifluoromethoxy)-3-pyridinyl]boronic acid (CAS 1008140-70-2) is a chemical compound with the molecular formula C6H5BF3NO3 and a molecular weight of 206.92 g/mol. IUPAC name: [6-(trifluoromethoxy)-3-pyridinyl]boronic acid. InChIKey: UTNFOSHVMVOKPG-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO3 |
|---|---|
| Molecular weight | 206.92 g/mol |
| IUPAC name | [6-(trifluoromethoxy)-3-pyridinyl]boronic acid |
| InChIKey | UTNFOSHVMVOKPG-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)