CAS 1008140-70-2 appears in our catalog under these names: 2-(Trifluoromethoxy)pyridine-5-boronic acid, 95%, (6-(Trifluoromethoxy)pyridin-3-yl)boronic acid, (6-(Trifluoromethoxy)pyridin-3-yl)boronic acid 97%, (6-(Trifluoromethoxy)pyridin-3-yl)boronic acid, 97%, 97%, (6-(Trifluoromethoxy)pyridin-3-yl)boronic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg, 25mg, 5g.
[6-(trifluoromethoxy)-3-pyridinyl]boronic acid (CAS 1008140-70-2) is a chemical compound with the molecular formula C6H5BF3NO3 and a molecular weight of 206.92 g/mol. IUPAC name: [6-(trifluoromethoxy)-3-pyridinyl]boronic acid. InChIKey: UTNFOSHVMVOKPG-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO3 |
|---|---|
| Molecular weight | 206.92 g/mol |
| IUPAC name | [6-(trifluoromethoxy)-3-pyridinyl]boronic acid |
| InChIKey | UTNFOSHVMVOKPG-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)