Products 2225155-71-3
CAS 2225155-71-3 is the registry number for 2–(Hydroxy)–6–(trifluoromethyl)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-oxo-6-(trifluoromethyl)-1H-pyridin-4-yl]boronic acid (CAS 2225155-71-3) is a chemical compound with the molecular formula C6H5BF3NO3 and a molecular weight of 206.92 g/mol. IUPAC name: [2-oxo-6-(trifluoromethyl)-1H-pyridin-4-yl]boronic acid. InChIKey: DPWNSQQWRXMCAB-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO3 |
|---|---|
| Molecular weight | 206.92 g/mol |
| IUPAC name | [2-oxo-6-(trifluoromethyl)-1H-pyridin-4-yl]boronic acid |
| InChIKey | DPWNSQQWRXMCAB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=O)NC(=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)