CAS 2377227-41-1 appears in our catalog under these names: [6-hydroxy-5-(trifluoromethyl)pyridin-3-yl]boronic acid, 95%, (6-Oxo-5-(trifluoromethyl)-1,6-dihydropyridin-3-yl)boronic acid, 98%, (6-Hydroxy-5-(trifluoromethyl)pyridin-3-yl)boronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 0,1g, 50mg, 0,25g.
[6-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]boronic acid (CAS 2377227-41-1) is a chemical compound with the molecular formula C6H5BF3NO3 and a molecular weight of 206.92 g/mol. IUPAC name: [6-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]boronic acid. InChIKey: FTNSVQKTQNKOHC-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO3 |
|---|---|
| Molecular weight | 206.92 g/mol |
| IUPAC name | [6-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]boronic acid |
| InChIKey | FTNSVQKTQNKOHC-UHFFFAOYSA-N |
| SMILES | B(C1=CNC(=O)C(=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)