Products 1448866-19-0
CAS 1448866-19-0 is the registry number for (2-(Trifluoromethoxy)pyridin-4-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(trifluoromethoxy)-4-pyridinyl]boronic acid (CAS 1448866-19-0) is a chemical compound with the molecular formula C6H5BF3NO3 and a molecular weight of 206.92 g/mol. IUPAC name: [2-(trifluoromethoxy)-4-pyridinyl]boronic acid. InChIKey: MIFOCYABWMFVHT-UHFFFAOYSA-N.
| Molecular formula | C6H5BF3NO3 |
|---|---|
| Molecular weight | 206.92 g/mol |
| IUPAC name | [2-(trifluoromethoxy)-4-pyridinyl]boronic acid |
| InChIKey | MIFOCYABWMFVHT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)