cas: 1072946-66-7 — see every product listed under this CAS number, including other names
(6-Chloro-5-fluoropyridin-3-yl)boronic acid, 95% (CAS 1072946-66-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222624-250MG |
| cas | 1072946-66-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 500mg | 232.23 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1627.57 Pln | |
| Fluorochem | 25g | 3288.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(6-chloro-5-fluoro-3-pyridinyl)boronic acid (CAS 1072946-66-7) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (6-chloro-5-fluoro-3-pyridinyl)boronic acid. InChIKey: NWEKVQKALFWZHQ-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (6-chloro-5-fluoro-3-pyridinyl)boronic acid |
| InChIKey | NWEKVQKALFWZHQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Cl)F)(O)O |
Computed by PubChem (NCBI)