(6-Chloro-5-fluoropyridin-3-yl)boronic acid, 97%, 97%
cas: 1072946-66-7 — see every product listed under this CAS number, including other names
(6-Chloro-5-fluoropyridin-3-yl)boronic acid, 97%, 97% (CAS 1072946-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BYV-100mg |
| cas | 1072946-66-7 |
| size | 100mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 500mg | 122.00 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1854.80 Pln | |
| Chemat | 50g | 3371.60 Pln | |
| Chemat | 100g | 6126.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(6-chloro-5-fluoro-3-pyridinyl)boronic acid (CAS 1072946-66-7) is a chemical compound with the molecular formula C5H4BClFNO2 and a molecular weight of 175.35 g/mol. IUPAC name: (6-chloro-5-fluoro-3-pyridinyl)boronic acid. InChIKey: NWEKVQKALFWZHQ-UHFFFAOYSA-N.
| Molecular formula | C5H4BClFNO2 |
|---|---|
| Molecular weight | 175.35 g/mol |
| IUPAC name | (6-chloro-5-fluoro-3-pyridinyl)boronic acid |
| InChIKey | NWEKVQKALFWZHQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Cl)F)(O)O |
Computed by PubChem (NCBI)