cas: 173194-95-1 — see every product listed under this CAS number, including other names
(6-Hydroxynaphthalen-2-yl)boronic acid 98% (CAS 173194-95-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A325171-100mg |
| cas | 173194-95-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 403.75 Pln | |
| Ambeed | 100g | 1215.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A325171 |
(6-hydroxynaphthalen-2-yl)boronic acid (CAS 173194-95-1) is a chemical compound with the molecular formula C10H9BO3 and a molecular weight of 187.99 g/mol. IUPAC name: (6-hydroxynaphthalen-2-yl)boronic acid. InChIKey: SNJANQMHRGSHFN-UHFFFAOYSA-N.
| Molecular formula | C10H9BO3 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (6-hydroxynaphthalen-2-yl)boronic acid |
| InChIKey | SNJANQMHRGSHFN-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)O)(O)O |
Computed by PubChem (NCBI)