CAS 173194-95-1 appears in our catalog under these names: 6-Hydroxy-2-naphthaleneboronic acid6-Hydroxy-2-naphthaleneboronic acid, >97%, 6–Hydroxy–2–naphthaleneboronic Acid (contains varying amounts of Anhydride), 6-Hydroxy-2-naphthaleneboronic Acid (contains varying amounts of Anhydride), 6-Hydroxynaphthalene-2-boronic acid, (6-Hydroxynaphthalen-2-yl)boronic acid 98%. Offered by: Lumtec, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: On request, 100g, 25g, 5g, 1g, 100mg, 250mg, 10g.
(6-hydroxynaphthalen-2-yl)boronic acid (CAS 173194-95-1) is a chemical compound with the molecular formula C10H9BO3 and a molecular weight of 187.99 g/mol. IUPAC name: (6-hydroxynaphthalen-2-yl)boronic acid. InChIKey: SNJANQMHRGSHFN-UHFFFAOYSA-N.
| Molecular formula | C10H9BO3 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (6-hydroxynaphthalen-2-yl)boronic acid |
| InChIKey | SNJANQMHRGSHFN-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)O)(O)O |
Computed by PubChem (NCBI)