CAS 151169-72-1 appears in our catalog under these names: 7-Hydroxynaphthalene-2-boronic acid, 95%, (7-Hydroxynaphthalen-2-yl)boronic acid, (7-Hydroxynaphthalen-2-yl)boronic acid 97%, 7-Hydroxynaphthalene-2-boronic acid, 98%, 98%, 7-Hydroxynaphthalene-2-boronic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 50mg, 0,5g.
(7-hydroxynaphthalen-2-yl)boronic acid (CAS 151169-72-1) is a chemical compound with the molecular formula C10H9BO3 and a molecular weight of 187.99 g/mol. IUPAC name: (7-hydroxynaphthalen-2-yl)boronic acid. InChIKey: MZWUEPMDFICBJA-UHFFFAOYSA-N.
| Molecular formula | C10H9BO3 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (7-hydroxynaphthalen-2-yl)boronic acid |
| InChIKey | MZWUEPMDFICBJA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=CC(=C2)O)(O)O |
Computed by PubChem (NCBI)