CAS 2096339-14-7 appears in our catalog under these names: (4-Phenylfuran-2-yl)boronic acid, 98%, 4–Phenylfuran–2–boronic acid. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 25mg.
(4-phenylfuran-2-yl)boronic acid (CAS 2096339-14-7) is a chemical compound with the molecular formula C10H9BO3 and a molecular weight of 187.99 g/mol. IUPAC name: (4-phenylfuran-2-yl)boronic acid. InChIKey: COEMLVVWWYHOPT-UHFFFAOYSA-N.
| Molecular formula | C10H9BO3 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (4-phenylfuran-2-yl)boronic acid |
| InChIKey | COEMLVVWWYHOPT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CO1)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)