CAS 1698028-43-1 appears in our catalog under these names: 3-Hydroxynaphthalene-1-boronic acid, 95%, (3-hydroxynaphthalen-1-yl)boronic Acid, (3-Hydroxynaphthalen-1-yl)boronic acid 98%, 3-Hydroxynaphthalene-1-boronic Acid, 98%, 98%, (3-Hydroxynaphthalen-1-yl)boronic acid, 98%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 500mg, 100mg.
(3-hydroxynaphthalen-1-yl)boronic acid (CAS 1698028-43-1) is a chemical compound with the molecular formula C10H9BO3 and a molecular weight of 187.99 g/mol. IUPAC name: (3-hydroxynaphthalen-1-yl)boronic acid. InChIKey: OJCMZQBOMVSRMS-UHFFFAOYSA-N.
| Molecular formula | C10H9BO3 |
|---|---|
| Molecular weight | 187.99 g/mol |
| IUPAC name | (3-hydroxynaphthalen-1-yl)boronic acid |
| InChIKey | OJCMZQBOMVSRMS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=CC=CC=C12)O)(O)O |
Computed by PubChem (NCBI)