CAS 10378-06-0 appears in our catalog under these names: 6R-FR054, >95% (HPLC), (6R)–FR054, (6R)-FR054/ 99.83% (existing batch purity), (3aR,7aR)-5-(Acetoxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d]oxazole-6,7-diyl diacetate, 95%, 95%, (6R)-FR054, 98.0%. Offered by: TRC, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 2,5g, 10mg, 100mg, 25mg, 5mg, 50mg, 250mg, 1g.
[(3aR,7aR)-6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate (CAS 10378-06-0) is a chemical compound with the molecular formula C14H19NO8 and a molecular weight of 329.30 g/mol. IUPAC name: [(3aR,7aR)-6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate. InChIKey: WZFQZRLQMXZMJA-IAPOMNSZSA-N.
| Molecular formula | C14H19NO8 |
|---|---|
| Molecular weight | 329.30 g/mol |
| IUPAC name | [(3aR,7aR)-6,7-diacetyloxy-2-methyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-5-yl]methyl acetate |
| InChIKey | WZFQZRLQMXZMJA-IAPOMNSZSA-N |
| SMILES | CC1=N[C@H]2[C@@H](O1)OC(C(C2OC(=O)C)OC(=O)C)COC(=O)C |
Computed by PubChem (NCBI)