(7-Fluorobenzo[d][1,3]dioxol-5-yl)methanesulfonyl chloride, 95%
cas: 1891612-07-9 — see every product listed under this CAS number, including other names
(7-Fluorobenzo[d][1,3]dioxol-5-yl)methanesulfonyl chloride, 95% (CAS 1891612-07-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A13091481-25mg |
| cas | 1891612-07-9 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 431.56 Pln | |
| Ambeed | 50mg | 676.31 Pln | |
| Ambeed | 100mg | 1104.63 Pln | |
| Ambeed | 250mg | 1933.44 Pln | |
| Ambeed | 1g | 5098.50 Pln | |
| BLDpharm | 25mg | 458.75 Pln | |
| BLDpharm | 50mg | 725.32 Pln | |
| BLDpharm | 100mg | 1186.27 Pln | |
| BLDpharm | 250mg | 2080.40 Pln | |
| BLDpharm | 1g | 5490.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(7-fluoro-1,3-benzodioxol-5-yl)methanesulfonyl chloride (CAS 1891612-07-9) is a chemical compound with the molecular formula C8H6ClFO4S and a molecular weight of 252.65 g/mol. IUPAC name: (7-fluoro-1,3-benzodioxol-5-yl)methanesulfonyl chloride. InChIKey: KTPITLPQAXEFCR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO4S |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | (7-fluoro-1,3-benzodioxol-5-yl)methanesulfonyl chloride |
| InChIKey | KTPITLPQAXEFCR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)CS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)