CAS 1909326-68-6 appears in our catalog under these names: 5-(Chlorosulfonyl)-3-fluoro-2-methylbenzoic acid, 95%, 5-(Chlorosulfonyl)-3-fluoro-2-methylbenzoic acid, 5-(Chlorosulfonyl)-3-fluoro-2-methylbenzoic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
5-chlorosulfonyl-3-fluoro-2-methylbenzoic acid (CAS 1909326-68-6) is a chemical compound with the molecular formula C8H6ClFO4S and a molecular weight of 252.65 g/mol. IUPAC name: 5-chlorosulfonyl-3-fluoro-2-methylbenzoic acid. InChIKey: ALDGQGJEEIQSFI-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO4S |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | 5-chlorosulfonyl-3-fluoro-2-methylbenzoic acid |
| InChIKey | ALDGQGJEEIQSFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1F)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)