CAS 926264-75-7 is the registry number for 3-(Chlorosulfonyl)-5-fluoro-4-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-chlorosulfonyl-5-fluoro-4-methylbenzoic acid (CAS 926264-75-7) is a chemical compound with the molecular formula C8H6ClFO4S and a molecular weight of 252.65 g/mol. IUPAC name: 3-chlorosulfonyl-5-fluoro-4-methylbenzoic acid. InChIKey: DIXGDMOYQRKMCG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO4S |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | 3-chlorosulfonyl-5-fluoro-4-methylbenzoic acid |
| InChIKey | DIXGDMOYQRKMCG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1S(=O)(=O)Cl)C(=O)O)F |
Computed by PubChem (NCBI)