CAS 1155909-75-3 is the registry number for Methyl 3-(chlorosulfonyl)-5-fluorobenzoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 3-chlorosulfonyl-5-fluorobenzoate (CAS 1155909-75-3) is a chemical compound with the molecular formula C8H6ClFO4S and a molecular weight of 252.65 g/mol. IUPAC name: methyl 3-chlorosulfonyl-5-fluorobenzoate. InChIKey: FNSURKZSHUELGB-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO4S |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | methyl 3-chlorosulfonyl-5-fluorobenzoate |
| InChIKey | FNSURKZSHUELGB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)