CAS 1374249-78-1 is the registry number for methyl 2-(chlorosulfonyl)-5-fluorobenzoate. Offered by: TRC. Available pack sizes: 250mg.
Methyl 2-chlorosulfonyl-5-fluorobenzoate (CAS 1374249-78-1) is a chemical compound with the molecular formula C8H6ClFO4S and a molecular weight of 252.65 g/mol. IUPAC name: methyl 2-chlorosulfonyl-5-fluorobenzoate. InChIKey: AZFGHWPSHRTFCC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO4S |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | methyl 2-chlorosulfonyl-5-fluorobenzoate |
| InChIKey | AZFGHWPSHRTFCC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)