cas: 209115-33-3 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl (5-hydroxypentyl)carbamate, 99.21% (CAS 209115-33-3) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 500 mg, 100 mg, 25 g, 5 g, 1 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W072176-10 g |
| cas | 209115-33-3 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1174.19 Pln | |
| MedChemExpress | 500 mg | 407.93 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 25 g | 2256.24 Pln | |
| MedChemExpress | 5 g | 765.52 Pln | |
| MedChemExpress | 1 g | 496.16 Pln | |
| MedChemExpress | 250 mg | 333.62 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.21% |
9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate (CAS 209115-33-3) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate. InChIKey: YNOWFUNORLDFTH-UHFFFAOYSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate |
| InChIKey | YNOWFUNORLDFTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCO |
Computed by PubChem (NCBI)