cas: 209115-33-3 — see every product listed under this CAS number, including other names
5-(Fmoc-amino)-1-pentanol, 97% (CAS 209115-33-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493301-1G |
| cas | 209115-33-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 529.00 Pln | |
| Fluorochem | 10g | 825.77 Pln | |
| Fluorochem | 25g | 1986.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate (CAS 209115-33-3) is a chemical compound with the molecular formula C20H23NO3 and a molecular weight of 325.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate. InChIKey: YNOWFUNORLDFTH-UHFFFAOYSA-N.
| Molecular formula | C20H23NO3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(5-hydroxypentyl)carbamate |
| InChIKey | YNOWFUNORLDFTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCO |
Computed by PubChem (NCBI)