cas: 156939-62-7 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate, 95%, 95% (CAS 156939-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112P5B-100mg |
| cas | 156939-62-7 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 890.00 Pln | |
| Chemat | 50g | 1509.20 Pln | |
| Chemat | 100g | 2474.00 Pln | |
| Chemat | 250g | 3597.20 Pln | |
| Chemat | 500g | 6619.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate (CAS 156939-62-7) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate. InChIKey: DBTMQODRSDEGRZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate |
| InChIKey | DBTMQODRSDEGRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC=O |
Computed by PubChem (NCBI)