CAS 156939-62-7 appears in our catalog under these names: (9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate, 95%, Fmoc-Gly-H 96% (stabilized with TEA), (9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg, 100g, 50g.
9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate (CAS 156939-62-7) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate. InChIKey: DBTMQODRSDEGRZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate |
| InChIKey | DBTMQODRSDEGRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC=O |
Computed by PubChem (NCBI)