CAS 1190198-13-0 appears in our catalog under these names: Methyl 7-(benzyloxy)-1h-indole-5-carboxylate, 95%, Methyl 7–(benzyloxy)–1H–indole–5–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 5g, 250mg.
Methyl 7-phenylmethoxy-1H-indole-5-carboxylate (CAS 1190198-13-0) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: methyl 7-phenylmethoxy-1H-indole-5-carboxylate. InChIKey: YIBLEJYPNQHEIQ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | methyl 7-phenylmethoxy-1H-indole-5-carboxylate |
| InChIKey | YIBLEJYPNQHEIQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C2C(=C1)C=CN2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)