CAS 96017-10-6 appears in our catalog under these names: 2-(1-Oxo-1,3-dihydro-2h-isoindol-2-yl)-3-phenylpropanoic acid, 95%, 2-(1-Oxoisoindolin-2-yl)-3-phenylpropanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanoic acid (CAS 96017-10-6) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanoic acid. InChIKey: FZEBPJBRDFXKIH-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 2-(3-oxo-1H-isoindol-2-yl)-3-phenylpropanoic acid |
| InChIKey | FZEBPJBRDFXKIH-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1C(CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)