Products 1216973-15-7

CAS 1216973-15-7 is the registry number for 4-[(2-Methylbenzyl)oxy]-1h-indole-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

4-[(2-methylphenyl)methoxy]-1H-indole-2-carboxylic acid (CAS 1216973-15-7) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 4-[(2-methylphenyl)methoxy]-1H-indole-2-carboxylic acid. InChIKey: DKHAYZLSEDAZNF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15NO3
Molecular weight281.30 g/mol
IUPAC name4-[(2-methylphenyl)methoxy]-1H-indole-2-carboxylic acid
InChIKeyDKHAYZLSEDAZNF-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1COC2=CC=CC3=C2C=C(N3)C(=O)O

Computed by PubChem (NCBI)