cas: 156939-62-7 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate (CAS 156939-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F235200-100MG |
| cas | 156939-62-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 674.78 Pln | |
| Fluorochem | 10g | 1278.73 Pln | |
| Fluorochem | 25g | 3080.18 Pln | |
| Fluorochem | 100g | 12118.67 Pln |
| delivery time | 3-4 weeks |
|---|
9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate (CAS 156939-62-7) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate. InChIKey: DBTMQODRSDEGRZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate |
| InChIKey | DBTMQODRSDEGRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC=O |
Computed by PubChem (NCBI)