cas: 156939-62-7 — see every product listed under this CAS number, including other names
Fmoc-Gly-H 96% (stabilized with TEA) (CAS 156939-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A438720-100mg |
| cas | 156939-62-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 804.25 Pln | |
| Ambeed | 10g | 1532.94 Pln | |
| Ambeed | 25g | 3707.88 Pln | |
| Ambeed | 100g | 14627.06 Pln |
| purity | 96% (stabilized with TEA) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A438720 |
9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate (CAS 156939-62-7) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate. InChIKey: DBTMQODRSDEGRZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-oxoethyl)carbamate |
| InChIKey | DBTMQODRSDEGRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC=O |
Computed by PubChem (NCBI)