cas: 40195-26-4 — see every product listed under this CAS number, including other names
(Cyclohexylidene(methoxy)methoxy)trimethylsilane, 95-<97% (CAS 40195-26-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6397-95-97-10g |
| cas | 40195-26-4 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 9195.34 Pln | |
| Hoffman Fine Chemicals | 25g | 18082.68 Pln | |
| Hoffman Fine Chemicals | 50g | 28750.04 Pln | |
| Hoffman Fine Chemicals | 100g | 45810.16 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
[cyclohexylidene(methoxy)methoxy]-trimethylsilane (CAS 40195-26-4) is a chemical compound with the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. IUPAC name: [cyclohexylidene(methoxy)methoxy]-trimethylsilane. InChIKey: ROBMZRJRPWOBGY-UHFFFAOYSA-N.
| Molecular formula | C11H22O2Si |
|---|---|
| Molecular weight | 214.38 g/mol |
| IUPAC name | [cyclohexylidene(methoxy)methoxy]-trimethylsilane |
| InChIKey | ROBMZRJRPWOBGY-UHFFFAOYSA-N |
| SMILES | COC(=C1CCCCC1)O[Si](C)(C)C |
Computed by PubChem (NCBI)