Products 2396521-63-2
CAS 2396521-63-2 appears in our catalog under these names: Silyl-ether based ROMP monomer iPrSi, Silyl-ether based ROMP monomer. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: 5 g, 500 mg, 1 g, 1G, 5G.
(6Z)-2,2-di(propan-2-yl)-5,8-dihydro-4H-1,3,2-dioxasilocine (CAS 2396521-63-2) is a chemical compound with the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. IUPAC name: (6Z)-2,2-di(propan-2-yl)-5,8-dihydro-4H-1,3,2-dioxasilocine. InChIKey: YBYQYMPJHKPHMH-WAYWQWQTSA-N.
| Molecular formula | C11H22O2Si |
|---|---|
| Molecular weight | 214.38 g/mol |
| IUPAC name | (6Z)-2,2-di(propan-2-yl)-5,8-dihydro-4H-1,3,2-dioxasilocine |
| InChIKey | YBYQYMPJHKPHMH-WAYWQWQTSA-N |
| SMILES | CC(C)[Si]1(OCC/C=C\CO1)C(C)C |
Computed by PubChem (NCBI)