cas: 31858-66-9 — see every product listed under this CAS number, including other names
(E)–Methyl mycophenolate (CAS 31858-66-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC38715-10 |
| cas | 31858-66-9 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 573.64 Pln | |
| GLPBio | 25mg | 732.77 Pln | |
| GLPBio | 5mg | 522.15 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 531.51 Pln | |
| GLPBio | 50mg | 919.99 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (CAS 31858-66-9) is a chemical compound with the molecular formula C18H22O6 and a molecular weight of 334.4 g/mol. IUPAC name: methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate. InChIKey: ZPXRQFLATDNYSS-BJMVGYQFSA-N.
| Molecular formula | C18H22O6 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| InChIKey | ZPXRQFLATDNYSS-BJMVGYQFSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)OC)O |
Computed by PubChem (NCBI)