cas: 31858-66-9 — see every product listed under this CAS number, including other names
Methyl mycophenolate, 98% (CAS 31858-66-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986278-1MG |
| cas | 31858-66-9 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1mg | 346.77 Pln | |
| Fluorochem | 5mg | 450.90 Pln | |
| Fluorochem | 10mg | 737.26 Pln | |
| Fluorochem | 25mg | 1424.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (CAS 31858-66-9) is a chemical compound with the molecular formula C18H22O6 and a molecular weight of 334.4 g/mol. IUPAC name: methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate. InChIKey: ZPXRQFLATDNYSS-BJMVGYQFSA-N.
| Molecular formula | C18H22O6 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| InChIKey | ZPXRQFLATDNYSS-BJMVGYQFSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)OC)O |
Computed by PubChem (NCBI)