CAS 72316-17-7 appears in our catalog under these names: trans-2-(4-methylphenyl)vinylboronic acid, 98%, (4–Methylstyryl)boronic acid, TRANS-2-(4-METHYLPHENYL)VINYLBORONIC AC, (E)-(4-Methylstyryl)boronic acid, 98%, 98%, (4-Methylstyryl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
[(E)-2-(4-methylphenyl)ethenyl]boronic acid (CAS 72316-17-7) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: [(E)-2-(4-methylphenyl)ethenyl]boronic acid. InChIKey: JJOBVKVXRDHVRP-VOTSOKGWSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | [(E)-2-(4-methylphenyl)ethenyl]boronic acid |
| InChIKey | JJOBVKVXRDHVRP-VOTSOKGWSA-N |
| SMILES | B(/C=C/C1=CC=C(C=C1)C)(O)O |
Computed by PubChem (NCBI)