cas: 1005174-17-3 — see every product listed under this CAS number, including other names
(E)-3-(2-Propyl-6-(trifluoromethyl)pyridin-3-yl)acrylic acid, 97% (CAS 1005174-17-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A142397-100mg |
| cas | 1005174-17-3 |
| size | 100mg |
| availability | USA Stock: 42.85g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 96.04 Pln | |
| Fluorochem | 250mg | 148.92 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 820.56 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 1126.88 Pln | |
| Ambeed | 100g | 3986.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid (CAS 1005174-17-3) is a chemical compound with the molecular formula C12H12F3NO2 and a molecular weight of 259.22 g/mol. IUPAC name: (E)-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid. InChIKey: CNCIJHJOEHBPBF-FNORWQNLSA-N.
| Molecular formula | C12H12F3NO2 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | (E)-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
| InChIKey | CNCIJHJOEHBPBF-FNORWQNLSA-N |
| SMILES | CCCC1=C(C=CC(=N1)C(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)