CAS 1005174-17-3 appears in our catalog under these names: (E)–3–(2–Propyl–6–(trifluoromethyl)pyridin–3–yl)acrylic acid, (E)-3-(2-Propyl-6-(trifluoromethyl)pyridin-3-yl)acrylic acid, 97%, (E)-3-(2-Propyl-6-(trifluoromethyl)pyridin-3-yl)acrylic acid, 97%, 97%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 25g, 100g.
(E)-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid (CAS 1005174-17-3) is a chemical compound with the molecular formula C12H12F3NO2 and a molecular weight of 259.22 g/mol. IUPAC name: (E)-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid. InChIKey: CNCIJHJOEHBPBF-FNORWQNLSA-N.
| Molecular formula | C12H12F3NO2 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | (E)-3-[2-propyl-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
| InChIKey | CNCIJHJOEHBPBF-FNORWQNLSA-N |
| SMILES | CCCC1=C(C=CC(=N1)C(F)(F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)