cas: 917760-91-9 — see every product listed under this CAS number, including other names
(E)-3-(5-Fluoropyridin-2-yl)-2-propenoic acid hydrochloride, 98% (CAS 917760-91-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F787980-250MG |
| cas | 917760-91-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 1101.71 Pln | |
| Fluorochem | 5g | 5287.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(E)-3-(5-fluoro-2-pyridinyl)prop-2-enoic acid;hydrochloride (CAS 917760-91-9) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: (E)-3-(5-fluoro-2-pyridinyl)prop-2-enoic acid;hydrochloride. InChIKey: KLQOYAXAULXMOO-BJILWQEISA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | (E)-3-(5-fluoro-2-pyridinyl)prop-2-enoic acid;hydrochloride |
| InChIKey | KLQOYAXAULXMOO-BJILWQEISA-N |
| SMILES | C1=CC(=NC=C1F)/C=C/C(=O)O.Cl |
Computed by PubChem (NCBI)