CAS 1214351-53-7 appears in our catalog under these names: Ethyl 2-chloro-3-fluoro-4-pyridinecarboxylate, 95%, Ethyl 2-chloro-3-fluoro-4-pyridinecarboxylate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
Ethyl 2-chloro-3-fluoropyridine-4-carboxylate (CAS 1214351-53-7) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: ethyl 2-chloro-3-fluoropyridine-4-carboxylate. InChIKey: LEDJRPLIHUMFFL-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | ethyl 2-chloro-3-fluoropyridine-4-carboxylate |
| InChIKey | LEDJRPLIHUMFFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC=C1)Cl)F |
Computed by PubChem (NCBI)