CAS 1268830-74-5 appears in our catalog under these names: Methyl 3-amino-2-chloro-6-fluorobenzoate, 98%, Methyl 3–amino–2–chloro–6–fluorobenzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
Methyl 3-amino-2-chloro-6-fluorobenzoate (CAS 1268830-74-5) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: methyl 3-amino-2-chloro-6-fluorobenzoate. InChIKey: ZQJVCISEAGMQIT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | methyl 3-amino-2-chloro-6-fluorobenzoate |
| InChIKey | ZQJVCISEAGMQIT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Cl)N)F |
Computed by PubChem (NCBI)