CAS 1804879-61-5 is the registry number for methyl 2-(5-chloro-3-fluoropyridin-2-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-(5-chloro-3-fluoro-2-pyridinyl)acetate (CAS 1804879-61-5) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: methyl 2-(5-chloro-3-fluoro-2-pyridinyl)acetate. InChIKey: PEADVXZKNZTETH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | methyl 2-(5-chloro-3-fluoro-2-pyridinyl)acetate |
| InChIKey | PEADVXZKNZTETH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=N1)Cl)F |
Computed by PubChem (NCBI)