CAS 261762-99-6 appears in our catalog under these names: 3-Chloro-4-fluoro-dl-phenylglycine, 95%, 2-Amino-2-(3-chloro-4-fluorophenyl)acetic acid, 98+%, 3–chloro–4–fluorophenylglycine, 3-Chloro-4-fluoro-DL-phenylglycine. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
2-amino-2-(3-chloro-4-fluorophenyl)acetic acid (CAS 261762-99-6) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: 2-amino-2-(3-chloro-4-fluorophenyl)acetic acid. InChIKey: DVSWHHQDQJPPBH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | 2-amino-2-(3-chloro-4-fluorophenyl)acetic acid |
| InChIKey | DVSWHHQDQJPPBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)N)Cl)F |
Computed by PubChem (NCBI)