(E)-3-(5-Nitrothiophen-2-yl)acrylic acid, 97%
cas: 50868-70-7 — see every product listed under this CAS number, including other names
(E)-3-(5-Nitrothiophen-2-yl)acrylic acid, 97% (CAS 50868-70-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A644033-1g |
| cas | 50868-70-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1755.44 Pln | |
| Ambeed | 25g | 6277.75 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1192.40 Pln | |
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 5g | 1799.38 Pln | |
| Fluorochem | 25g | 6297.80 Pln | |
| BLDpharm | 1g | 447.64 Pln | |
| BLDpharm | 5g | 1891.58 Pln | |
| BLDpharm | 25g | 6762.09 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid (CAS 50868-70-7) is a chemical compound with the molecular formula C7H5NO4S and a molecular weight of 199.19 g/mol. IUPAC name: (E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid. InChIKey: IIJCRPJUZLOCIE-DUXPYHPUSA-N.
| Molecular formula | C7H5NO4S |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | (E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid |
| InChIKey | IIJCRPJUZLOCIE-DUXPYHPUSA-N |
| SMILES | C1=C(SC(=C1)[N+](=O)[O-])/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid, 3-(5-Nitrothiophen-2-yl)acrylic acid, (E)-3-(5-nitrothiophen-2-yl)acrylic acid, 3-(5-Nitro-2-thiophene)acrylic Acid, (E)-3-(5-nitrothiophen-2-yl)prop-2-enoic acid, (E)-3-(5-Nitro-2-thienyl)acrylic acid, (E)-3-(5-Nitrothien-2-yl)acrylic acid, (2E)-3-(5-nitrothiophen-2-yl)prop-2-enoicacid, (E)-3-(2-nitrothiophen-5-yl)propenoic acid, (E)-3-(5-nitrothiophen-2-yl)acrylicacid