CAS 74299-91-5 appears in our catalog under these names: (E)–4,4'–(ethene–1,2–diyl)dibenzoic acid, (E)-4,4'-(ethene-1,2-diyl)dibenzoic acid, 98%, 98%, (E)-4,4'-(ETHENE-1,2-DIYL)DIBENZOIC ACID, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 500mg, 1g, 15g, 25g.
4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid (CAS 74299-91-5) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid. InChIKey: SBBQDUFLZGOASY-OWOJBTEDSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 4-[(E)-2-(4-carboxyphenyl)ethenyl]benzoic acid |
| InChIKey | SBBQDUFLZGOASY-OWOJBTEDSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)