CAS 6889-78-7 appears in our catalog under these names: 3-Hydroxy-4'-methoxyflavone, 98%, 4'-Methoxyflavonol, 3-Hydroxy-4'-methoxyflavone, >98.0%(HPLC), 3-Hydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one, 98%, 98%, 4'-Methoxyflavonol, 98.00%. Offered by: Combi-blocks, Biosynth, TCI, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100mg, 250mg, 500 mg.
3-hydroxy-2-(4-methoxyphenyl)chromen-4-one (CAS 6889-78-7) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: IIBBFGMVMNZMGA-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 3-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | IIBBFGMVMNZMGA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)