CAS 6003-12-9 is the registry number for 1,2-Dimethoxyanthracene-9,10-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1,2-dimethoxyanthracene-9,10-dione (CAS 6003-12-9) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 1,2-dimethoxyanthracene-9,10-dione. InChIKey: AMKRBKSZCGCEJK-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 1,2-dimethoxyanthracene-9,10-dione |
| InChIKey | AMKRBKSZCGCEJK-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3C2=O)OC |
Computed by PubChem (NCBI)