CAS 487-24-1 appears in our catalog under these names: 7-Hydroxy-4'-methoxyflavone, 95%, Pratol, >95% (HPLC), Pratol/ 99.58% (existing batch purity), Pratol. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 200mg, 25mg, 50mg, 2mg, 5mg, 10mg.
7-hydroxy-2-(4-methoxyphenyl)chromen-4-one (CAS 487-24-1) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: 7-hydroxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: SQVXWIUVAILQRH-UHFFFAOYSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | 7-hydroxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | SQVXWIUVAILQRH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)O |
Computed by PubChem (NCBI)